C11H15MgNO9S — CID 54689970
magnesium;2-acetamido-3-sulfidopropanoate;2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one (PubChem CID 54689970) has the molecular formula C11H15MgNO9S and a molecular weight of 361.61 g/mol. Its IUPAC name is magnesium;2-acetamido-3-sulfidopropanoate;2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one.
| Compound Name | magnesium;2-acetamido-3-sulfidopropanoate;2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 54689970 |
| Molecular Formula | C11H15MgNO9S |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | magnesium;2-acetamido-3-sulfidopropanoate;2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one |
| SMILES | CC(=O)NC(C[S-])C(=O)[O-].O=C1OC(C(O)CO)C(O)=C1O.[Mg+2] |
| InChI | InChI=1S/C6H8O6.C5H9NO3S.Mg/c7-1-2(8)5-3(9)4(10)6(11)12-5;1-3(7)6-4(2-10)5(8)9;/h2,5,7-10H,1H2;4,10H,2H2,1H3,(H,6,7)(H,8,9);/q;;+2/p-2 |
| InChIKey | IGXKRPAANKUOGV-UHFFFAOYSA-L |
| XLogP | -4.00 |
| TPSA | 176.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|