C8H7F3O5 — CID 54690040
2,2-dimethyl-5-(2,2,2-trifluoro-1-hydroxyethylidene)-1,3-dioxane-4,6-dione (PubChem CID 54690040) has the molecular formula C8H7F3O5 and a molecular weight of 240.13 g/mol. Its IUPAC name is 2,2-dimethyl-5-(2,2,2-trifluoro-1-hydroxyethylidene)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(2,2,2-trifluoro-1-hydroxyethylidene)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 54690040 |
| Molecular Formula | C8H7F3O5 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2,2-dimethyl-5-(2,2,2-trifluoro-1-hydroxyethylidene)-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C(O)C(F)(F)F)C(=O)O1 |
| InChI | InChI=1S/C8H7F3O5/c1-7(2)15-5(13)3(6(14)16-7)4(12)8(9,10)11/h12H,1-2H3 |
| InChIKey | ORFUNFJWGXIUIA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|