C34H37N3O8 — CID 54690251
N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(2-cyclohexylethyl)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyridine-3-carboxamide (PubChem CID 54690251) has the molecular formula C34H37N3O8 and a molecular weight of 615.68 g/mol. Its IUPAC name is N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(2-cyclohexylethyl)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(2-cyclohexylethyl)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54690251 |
| Molecular Formula | C34H37N3O8 |
| Molecular Weight | 615.68 g/mol |
| Exact Mass | 615.26 |
| IUPAC Name | N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(2-cyclohexylethyl)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]pyridine-3-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(CNC(=O)c5cccnc5)cc(CCC5CCCCC5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C34H37N3O8/c35-32(43)27-24(38)14-22-12-20-13-23-18(9-8-17-5-2-1-3-6-17)11-21(16-37-33(44)19-7-4-10-36-15-19)28(39)26(23)29(40)25(20)30(41)34(22,45)31(27)42/h4,7,10-11,15,17,20,22,39-40,42,45H,1-3,5-6,8-9,12-14,16H2,(H2,35,43)(H,37,44)/t20-,22+,34+/m1/s1 |
| InChIKey | SBNKAESTFPPYMC-SULRNWAHSA-N |
| XLogP | 3.26 |
| TPSA | 200.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.68 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|