C30H45NO4 — CID 54690389
4-[(4E,6E,8S,11Z)-13-[(2S)-3-hydroxy-4-methyl-5-oxo-2H-furan-2-yl]-4,8,12-trimethyltrideca-4,6,11-trienyl]-1-(3-methylbutyl)-2H-pyrrol-5-one (PubChem CID 54690389) has the molecular formula C30H45NO4 and a molecular weight of 483.69 g/mol. Its IUPAC name is 4-[(4E,6E,8S,11Z)-13-[(2S)-3-hydroxy-4-methyl-5-oxo-2H-furan-2-yl]-4,8,12-trimethyltrideca-4,6,11-trienyl]-1-(3-methylbutyl)-2H-pyrrol-5-one.
| Compound Name | 4-[(4E,6E,8S,11Z)-13-[(2S)-3-hydroxy-4-methyl-5-oxo-2H-furan-2-yl]-4,8,12-trimethyltrideca-4,6,11-trienyl]-1-(3-methylbutyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 54690389 |
| Molecular Formula | C30H45NO4 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | 4-[(4E,6E,8S,11Z)-13-[(2S)-3-hydroxy-4-methyl-5-oxo-2H-furan-2-yl]-4,8,12-trimethyltrideca-4,6,11-trienyl]-1-(3-methylbutyl)-2H-pyrrol-5-one |
| SMILES | CC1=C(O)[C@H](C/C(C)=C\CC[C@H](C)/C=C/C=C(\C)CCCC2=CCN(CCC(C)C)C2=O)OC1=O |
| InChI | InChI=1S/C30H45NO4/c1-21(2)16-18-31-19-17-26(29(31)33)15-9-13-23(4)11-7-10-22(3)12-8-14-24(5)20-27-28(32)25(6)30(34)35-27/h7,10-11,14,17,21-22,27,32H,8-9,12-13,15-16,18-20H2,1-6H3/b10-7+,23-11+,24-14-/t22-,27+/m1/s1 |
| InChIKey | IDSXOIOXEMBIDK-QAVDTZCXSA-N |
| XLogP | 6.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|