About 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine
2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine (PubChem CID 546908) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine |
| PubChem CID | 546908 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C13H23N/c1-13(2)11-6-5-10(12(13)9-11)7-8-14(3)4/h5,11-12H,6-9H2,1-4H3 |
| InChIKey | VDWWSWVFXKVAHE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine?
The IUPAC name of 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine (CID 546908) is 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine is CN(C)CCC1=CCC2CC1C2(C)C.
What is the InChIKey of 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine?
The InChIKey is VDWWSWVFXKVAHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-13(2)11-6-5-10(12(13)9-11)7-8-14(3)4/h5,11-12H,6-9H2,1-4H3.
What are the key properties of 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine?
2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine has a molecular weight of 193.33 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-N,N-dimethylethanamine is sourced from PubChem (CID 546908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).