About 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide
4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide (PubChem CID 54690810) has the molecular formula C23H18N2O6
and a molecular weight of 418.41 g/mol. Its IUPAC name is 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide |
| PubChem CID | 54690810 |
| Molecular Formula | C23H18N2O6 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide |
| SMILES | CN(C(=O)c1c(N(C)c2ccccc2)oc(=O)c2c(O)cc(=O)oc12)c1ccccc1 |
| InChI | InChI=1S/C23H18N2O6/c1-24(14-9-5-3-6-10-14)21(28)19-20-18(16(26)13-17(27)30-20)23(29)31-22(19)25(2)15-11-7-4-8-12-15/h3-13,26H,1-2H3 |
| InChIKey | BCXMEHCJGAGTQS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide?
The IUPAC name of 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide (CID 54690810) is 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide.
What is the SMILES notation for 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide?
The canonical SMILES for 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide is CN(C(=O)c1c(N(C)c2ccccc2)oc(=O)c2c(O)cc(=O)oc12)c1ccccc1.
What is the InChIKey of 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide?
The InChIKey is BCXMEHCJGAGTQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O6/c1-24(14-9-5-3-6-10-14)21(28)19-20-18(16(26)13-17(27)30-20)23(29)31-22(19)25(2)15-11-7-4-8-12-15/h3-13,26H,1-2H3.
What are the key properties of 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide?
4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide has a molecular weight of 418.41 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N-methyl-7-(N-methylanilino)-2,5-dioxo-N-phenylpyrano[4,3-b]pyran-8-carboxamide is sourced from PubChem (CID 54690810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).