C29H30O7S — CID 54691121
4-[[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]methylsulfonyl]benzoic acid (PubChem CID 54691121) has the molecular formula C29H30O7S and a molecular weight of 522.62 g/mol. Its IUPAC name is 4-[[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]methylsulfonyl]benzoic acid.
| Compound Name | 4-[[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 54691121 |
| Molecular Formula | C29H30O7S |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 4-[[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]methylsulfonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Cc2cccc(C(c3c(O)c4c(oc3=O)CCCCCC4)C3CC3)c2)cc1 |
| InChI | InChI=1S/C29H30O7S/c30-27-23-8-3-1-2-4-9-24(23)36-29(33)26(27)25(19-10-11-19)21-7-5-6-18(16-21)17-37(34,35)22-14-12-20(13-15-22)28(31)32/h5-7,12-16,19,25,30H,1-4,8-11,17H2,(H,31,32) |
| InChIKey | DJIHQKUFYTXKJR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |