C16H17NO2 — CID 54691169
7-hydroxy-2,2-dimethyl-6-phenyl-1,3-dihydroindolizin-5-one (PubChem CID 54691169) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 7-hydroxy-2,2-dimethyl-6-phenyl-1,3-dihydroindolizin-5-one.
| Compound Name | 7-hydroxy-2,2-dimethyl-6-phenyl-1,3-dihydroindolizin-5-one |
|---|---|
| PubChem CID | 54691169 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 7-hydroxy-2,2-dimethyl-6-phenyl-1,3-dihydroindolizin-5-one |
| SMILES | CC1(C)Cc2cc(O)c(-c3ccccc3)c(=O)n2C1 |
| InChI | InChI=1S/C16H17NO2/c1-16(2)9-12-8-13(18)14(15(19)17(12)10-16)11-6-4-3-5-7-11/h3-8,18H,9-10H2,1-2H3 |
| InChIKey | OPXWOAHXOWOACA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |