About 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one
6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one (PubChem CID 54691170) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one.
Molecular Properties
| Compound Name | 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one |
| PubChem CID | 54691170 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one |
| SMILES | CC1(C)Cc2cc(O)c(Cc3ccccc3)c(=O)n2C1 |
| InChI | InChI=1S/C17H19NO2/c1-17(2)10-13-9-15(19)14(16(20)18(13)11-17)8-12-6-4-3-5-7-12/h3-7,9,19H,8,10-11H2,1-2H3 |
| InChIKey | MUGJPGYUTOKMRH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one?
The IUPAC name of 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one (CID 54691170) is 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one.
What is the SMILES notation for 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one?
The canonical SMILES for 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one is CC1(C)Cc2cc(O)c(Cc3ccccc3)c(=O)n2C1.
What is the InChIKey of 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one?
The InChIKey is MUGJPGYUTOKMRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-17(2)10-13-9-15(19)14(16(20)18(13)11-17)8-12-6-4-3-5-7-12/h3-7,9,19H,8,10-11H2,1-2H3.
What are the key properties of 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one?
6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one has a molecular weight of 269.34 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-7-hydroxy-2,2-dimethyl-1,3-dihydroindolizin-5-one is sourced from PubChem (CID 54691170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).