C14H13NO2 — CID 54691173
7-hydroxy-6-phenyl-2,3-dihydro-1H-indolizin-5-one (PubChem CID 54691173) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 7-hydroxy-6-phenyl-2,3-dihydro-1H-indolizin-5-one.
| Compound Name | 7-hydroxy-6-phenyl-2,3-dihydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 54691173 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 7-hydroxy-6-phenyl-2,3-dihydro-1H-indolizin-5-one |
| SMILES | O=c1c(-c2ccccc2)c(O)cc2n1CCC2 |
| InChI | InChI=1S/C14H13NO2/c16-12-9-11-7-4-8-15(11)14(17)13(12)10-5-2-1-3-6-10/h1-3,5-6,9,16H,4,7-8H2 |
| InChIKey | LMNBRQVWUBMBHO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |