About 3-amino-4,7-dihydroxychromen-2-one
3-amino-4,7-dihydroxychromen-2-one (PubChem CID 54691343) has the molecular formula C9H7NO4
and a molecular weight of 193.16 g/mol. Its IUPAC name is 3-amino-4,7-dihydroxychromen-2-one.
Molecular Properties
| Compound Name | 3-amino-4,7-dihydroxychromen-2-one |
| PubChem CID | 54691343 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 3-amino-4,7-dihydroxychromen-2-one |
| SMILES | Nc1c(O)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C9H7NO4/c10-7-8(12)5-2-1-4(11)3-6(5)14-9(7)13/h1-3,11-12H,10H2 |
| InChIKey | QVNNPTBCHMRANE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4,7-dihydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,7-dihydroxychromen-2-one?
The IUPAC name of 3-amino-4,7-dihydroxychromen-2-one (CID 54691343) is 3-amino-4,7-dihydroxychromen-2-one.
What is the SMILES notation for 3-amino-4,7-dihydroxychromen-2-one?
The canonical SMILES for 3-amino-4,7-dihydroxychromen-2-one is Nc1c(O)c2ccc(O)cc2oc1=O.
What is the InChIKey of 3-amino-4,7-dihydroxychromen-2-one?
The InChIKey is QVNNPTBCHMRANE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO4/c10-7-8(12)5-2-1-4(11)3-6(5)14-9(7)13/h1-3,11-12H,10H2.
What are the key properties of 3-amino-4,7-dihydroxychromen-2-one?
3-amino-4,7-dihydroxychromen-2-one has a molecular weight of 193.16 g/mol, XLogP of 0.79, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,7-dihydroxychromen-2-one is sourced from PubChem (CID 54691343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).