About 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one
3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one (PubChem CID 54691525) has the molecular formula C21H27NO5
and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one.
Molecular Properties
| Compound Name | 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one |
| PubChem CID | 54691525 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one |
| SMILES | CC(=O)c1c(O)c(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cn(O)c1=O |
| InChI | InChI=1S/C21H27NO5/c1-11(23)16-17(24)13(10-22(27)19(16)26)12-8-14(20(2,3)4)18(25)15(9-12)21(5,6)7/h8-10,24-25,27H,1-7H3 |
| InChIKey | WJSQVDWMQTYJLM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one?
The IUPAC name of 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one (CID 54691525) is 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one.
What is the SMILES notation for 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one?
The canonical SMILES for 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one is CC(=O)c1c(O)c(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cn(O)c1=O.
What is the InChIKey of 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one?
The InChIKey is WJSQVDWMQTYJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO5/c1-11(23)16-17(24)13(10-22(27)19(16)26)12-8-14(20(2,3)4)18(25)15(9-12)21(5,6)7/h8-10,24-25,27H,1-7H3.
What are the key properties of 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one?
3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one has a molecular weight of 373.45 g/mol, XLogP of 3.96, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,4-dihydroxypyridin-2-one is sourced from PubChem (CID 54691525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).