About 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid
1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid (PubChem CID 54691728) has the molecular formula C9H13NO6
and a molecular weight of 231.20 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid |
| PubChem CID | 54691728 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid |
| SMILES | COC(CN1CC(C(=O)O)=C(O)C1=O)OC |
| InChI | InChI=1S/C9H13NO6/c1-15-6(16-2)4-10-3-5(9(13)14)7(11)8(10)12/h6,11H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | XDUDACNCYDQIKQ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid?
The IUPAC name of 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid (CID 54691728) is 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid.
What is the SMILES notation for 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid?
The canonical SMILES for 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid is COC(CN1CC(C(=O)O)=C(O)C1=O)OC.
What is the InChIKey of 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid?
The InChIKey is XDUDACNCYDQIKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO6/c1-15-6(16-2)4-10-3-5(9(13)14)7(11)8(10)12/h6,11H,3-4H2,1-2H3,(H,13,14).
What are the key properties of 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid?
1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid has a molecular weight of 231.20 g/mol, XLogP of -0.66, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethoxyethyl)-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylic acid is sourced from PubChem (CID 54691728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).