About 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid
7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid (PubChem CID 54691738) has the molecular formula C20H24Cl2N2O5
and a molecular weight of 443.33 g/mol. Its IUPAC name is 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid.
Molecular Properties
| Compound Name | 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid |
| PubChem CID | 54691738 |
| Molecular Formula | C20H24Cl2N2O5 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)C1=C(O)C(=O)N(CCCCCCC(=O)O)C1 |
| InChI | InChI=1S/C20H24Cl2N2O5/c1-23(11-13-7-8-15(21)16(22)10-13)19(28)14-12-24(20(29)18(14)27)9-5-3-2-4-6-17(25)26/h7-8,10,27H,2-6,9,11-12H2,1H3,(H,25,26) |
| InChIKey | VNORSHAJJCSTOX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid?
The IUPAC name of 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid (CID 54691738) is 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid.
What is the SMILES notation for 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid?
The canonical SMILES for 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid is CN(Cc1ccc(Cl)c(Cl)c1)C(=O)C1=C(O)C(=O)N(CCCCCCC(=O)O)C1.
What is the InChIKey of 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid?
The InChIKey is VNORSHAJJCSTOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24Cl2N2O5/c1-23(11-13-7-8-15(21)16(22)10-13)19(28)14-12-24(20(29)18(14)27)9-5-3-2-4-6-17(25)26/h7-8,10,27H,2-6,9,11-12H2,1H3,(H,25,26).
What are the key properties of 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid?
7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid has a molecular weight of 443.33 g/mol, XLogP of 3.64, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-[(3,4-dichlorophenyl)methyl-methylcarbamoyl]-4-hydroxy-5-oxo-2H-pyrrol-1-yl]heptanoic acid is sourced from PubChem (CID 54691738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).