C28H36N4O9 — CID 54691817
(4S,5S,6R,12aR)-9-[[2-(diethylamino)acetyl]amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54691817) has the molecular formula C28H36N4O9 and a molecular weight of 572.62 g/mol. Its IUPAC name is (4S,5S,6R,12aR)-9-[[2-(diethylamino)acetyl]amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,5S,6R,12aR)-9-[[2-(diethylamino)acetyl]amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54691817 |
| Molecular Formula | C28H36N4O9 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | (4S,5S,6R,12aR)-9-[[2-(diethylamino)acetyl]amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCN(CC)CC(=O)Nc1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C1[C@H]2C |
| InChI | InChI=1S/C28H36N4O9/c1-6-32(7-2)10-14(33)30-13-9-8-12-11(3)15-17(22(35)16(12)21(13)34)25(38)28(41)19(23(15)36)20(31(4)5)24(37)18(26(28)39)27(29)40/h8-9,11,15,19-20,23,34-36,39,41H,6-7,10H2,1-5H3,(H2,29,40)(H,30,33)/t11-,15?,19?,20-,23?,28-/m0/s1 |
| InChIKey | WYXLBPJEPHTUOH-GZKAEHRLSA-N |
| XLogP | -0.22 |
| TPSA | 213.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|