C28H27N3O8 — CID 54691898
4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(2-pyridin-2-ylacetyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54691898) has the molecular formula C28H27N3O8 and a molecular weight of 533.54 g/mol. Its IUPAC name is 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(2-pyridin-2-ylacetyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(2-pyridin-2-ylacetyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54691898 |
| Molecular Formula | C28H27N3O8 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(2-pyridin-2-ylacetyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(C(=O)Cc5ccccn5)c4CC3CC12 |
| InChI | InChI=1S/C28H27N3O8/c1-31(2)22-16-10-12-9-15-14(18(33)11-13-5-3-4-8-30-13)6-7-17(32)20(15)23(34)19(12)25(36)28(16,39)26(37)21(24(22)35)27(29)38/h3-8,12,16,22,32,34,37,39H,9-11H2,1-2H3,(H2,29,38) |
| InChIKey | JREVVESKDPWJFJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 191.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|