C35H31F3N4O9 — CID 54691915
4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54691915) has the molecular formula C35H31F3N4O9 and a molecular weight of 708.65 g/mol. Its IUPAC name is 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54691915 |
| Molecular Formula | C35H31F3N4O9 |
| Molecular Weight | 708.65 g/mol |
| Exact Mass | 708.20 |
| IUPAC Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(NC(=O)Nc6ccc(OC(F)(F)F)cc6)cc5)c4CC3CC12 |
| InChI | InChI=1S/C35H31F3N4O9/c1-42(2)27-22-14-16-13-21-20(15-3-5-17(6-4-15)40-33(49)41-18-7-9-19(10-8-18)51-35(36,37)38)11-12-23(43)25(21)28(44)24(16)30(46)34(22,50)31(47)26(29(27)45)32(39)48/h3-12,16,22,27,43-44,47,50H,13-14H2,1-2H3,(H2,39,48)(H2,40,41,49) |
| InChIKey | NCNSVYPRIJYKQB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 211.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|