C33H30N4O11 — CID 54692099
methyl 3-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-5-(1,2-oxazole-5-carbonylamino)benzoate (PubChem CID 54692099) has the molecular formula C33H30N4O11 and a molecular weight of 658.62 g/mol. Its IUPAC name is methyl 3-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-5-(1,2-oxazole-5-carbonylamino)benzoate.
| Compound Name | methyl 3-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-5-(1,2-oxazole-5-carbonylamino)benzoate |
|---|---|
| PubChem CID | 54692099 |
| Molecular Formula | C33H30N4O11 |
| Molecular Weight | 658.62 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | methyl 3-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-5-(1,2-oxazole-5-carbonylamino)benzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccno2)cc(-c2ccc(O)c3c2CC2CC4C(N(C)C)C(=O)C(C(N)=O)=C(O)C4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C33H30N4O11/c1-37(2)25-19-12-14-11-18-17(13-8-15(32(45)47-3)10-16(9-13)36-31(44)21-6-7-35-48-21)4-5-20(38)23(18)26(39)22(14)28(41)33(19,46)29(42)24(27(25)40)30(34)43/h4-10,14,19,25,38-39,42,46H,11-12H2,1-3H3,(H2,34,43)(H,36,44) |
| InChIKey | MENXNWKIIQRQQR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 242.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.62 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|