C20H17NO9 — CID 54692192
(4aR,12aR)-1,4a,10,11,12a-pentahydroxy-8-methoxy-3,12-dioxo-4,5-dihydrotetracene-2-carboxamide (PubChem CID 54692192) has the molecular formula C20H17NO9 and a molecular weight of 415.35 g/mol. Its IUPAC name is (4aR,12aR)-1,4a,10,11,12a-pentahydroxy-8-methoxy-3,12-dioxo-4,5-dihydrotetracene-2-carboxamide.
| Compound Name | (4aR,12aR)-1,4a,10,11,12a-pentahydroxy-8-methoxy-3,12-dioxo-4,5-dihydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54692192 |
| Molecular Formula | C20H17NO9 |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | (4aR,12aR)-1,4a,10,11,12a-pentahydroxy-8-methoxy-3,12-dioxo-4,5-dihydrotetracene-2-carboxamide |
| SMILES | COc1cc(O)c2c(O)c3c(cc2c1)C[C@@]1(O)CC(=O)C(C(N)=O)=C(O)[C@@]1(O)C3=O |
| InChI | InChI=1S/C20H17NO9/c1-30-9-3-7-2-8-5-19(28)6-11(23)14(18(21)27)17(26)20(19,29)16(25)13(8)15(24)12(7)10(22)4-9/h2-4,22,24,26,28-29H,5-6H2,1H3,(H2,21,27)/t19-,20+/m1/s1 |
| InChIKey | HWLAJZAXDIBLQS-UXHICEINSA-N |
| XLogP | -0.27 |
| TPSA | 187.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|