About (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine
(NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine (PubChem CID 5469235) has the molecular formula C17H13F6NO2
and a molecular weight of 377.28 g/mol. Its IUPAC name is (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine |
| PubChem CID | 5469235 |
| Molecular Formula | C17H13F6NO2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1ccc(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H13F6NO2/c1-10(24-25)12-2-4-15(5-3-12)26-9-11-6-13(16(18,19)20)8-14(7-11)17(21,22)23/h2-8,25H,9H2,1H3/b24-10- |
| InChIKey | WNXDHQOVUHWKNN-VROXFSQNSA-N |
| XLogP | 5.50 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine (CID 5469235) is (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine is C/C(=N/O)c1ccc(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1.
What is the InChIKey of (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine?
The InChIKey is WNXDHQOVUHWKNN-VROXFSQNSA-N. The full InChI is InChI=1S/C17H13F6NO2/c1-10(24-25)12-2-4-15(5-3-12)26-9-11-6-13(16(18,19)20)8-14(7-11)17(21,22)23/h2-8,25H,9H2,1H3/b24-10-.
What are the key properties of (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine?
(NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine has a molecular weight of 377.28 g/mol, XLogP of 5.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]hydroxylamine is sourced from PubChem (CID 5469235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).