C20H21ClFN3O3 — CID 54692389
5-[(3-chloro-4-fluorophenyl)methyl]-11-ethyl-8-hydroxy-12-methyl-1,5,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene-6,10-dione (PubChem CID 54692389) has the molecular formula C20H21ClFN3O3 and a molecular weight of 405.86 g/mol. Its IUPAC name is 5-[(3-chloro-4-fluorophenyl)methyl]-11-ethyl-8-hydroxy-12-methyl-1,5,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene-6,10-dione.
| Compound Name | 5-[(3-chloro-4-fluorophenyl)methyl]-11-ethyl-8-hydroxy-12-methyl-1,5,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene-6,10-dione |
|---|---|
| PubChem CID | 54692389 |
| Molecular Formula | C20H21ClFN3O3 |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 5-[(3-chloro-4-fluorophenyl)methyl]-11-ethyl-8-hydroxy-12-methyl-1,5,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene-6,10-dione |
| SMILES | CCN1C(=O)c2c(O)c3c(n2CC1C)CCN(Cc1ccc(F)c(Cl)c1)C3=O |
| InChI | InChI=1S/C20H21ClFN3O3/c1-3-24-11(2)9-25-15-6-7-23(10-12-4-5-14(22)13(21)8-12)19(27)16(15)18(26)17(25)20(24)28/h4-5,8,11,26H,3,6-7,9-10H2,1-2H3 |
| InChIKey | IQHPGRAWKWEYMT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |