C15H16N2O4 — CID 54692483
(Z)-[(6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]-pent-4-en-2-yloxymethanolate (PubChem CID 54692483) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is (Z)-[(6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]-pent-4-en-2-yloxymethanolate.
| Compound Name | (Z)-[(6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]-pent-4-en-2-yloxymethanolate |
|---|---|
| PubChem CID | 54692483 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (Z)-[(6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]-pent-4-en-2-yloxymethanolate |
| SMILES | C=CCC(C)O/C([O-])=C1/C=CC=C/C1=N\N=[C+]\C(=O)OC |
| InChI | InChI=1S/C15H16N2O4/c1-4-7-11(2)21-15(19)12-8-5-6-9-13(12)17-16-10-14(18)20-3/h4-6,8-9,11H,1,7H2,2-3H3 |
| InChIKey | HRDYKYSFWAVIDV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|