C18H24N2O2S — CID 54692589
1-ethyl-4-hydroxy-6-methyl-3-[piperidin-1-yl(thiophen-2-yl)methyl]pyridin-2-one (PubChem CID 54692589) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-ethyl-4-hydroxy-6-methyl-3-[piperidin-1-yl(thiophen-2-yl)methyl]pyridin-2-one.
| Compound Name | 1-ethyl-4-hydroxy-6-methyl-3-[piperidin-1-yl(thiophen-2-yl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 54692589 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-ethyl-4-hydroxy-6-methyl-3-[piperidin-1-yl(thiophen-2-yl)methyl]pyridin-2-one |
| SMILES | CCn1c(C)cc(O)c(C(c2cccs2)N2CCCCC2)c1=O |
| InChI | InChI=1S/C18H24N2O2S/c1-3-20-13(2)12-14(21)16(18(20)22)17(15-8-7-11-23-15)19-9-5-4-6-10-19/h7-8,11-12,17,21H,3-6,9-10H2,1-2H3 |
| InChIKey | ZHNRRHVEWUECIL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |