C27H28O4S2 — CID 5469263
[(1Z,3E)-1-[(7Z)-6-oxo-8-phenyl-3,4-dihydro-2H-1,5-dithiocin-7-yl]-4-phenyl-1-propan-2-yloxybuta-1,3-dien-2-yl] acetate (PubChem CID 5469263) has the molecular formula C27H28O4S2 and a molecular weight of 480.65 g/mol. Its IUPAC name is [(1Z,3E)-1-[(7Z)-6-oxo-8-phenyl-3,4-dihydro-2H-1,5-dithiocin-7-yl]-4-phenyl-1-propan-2-yloxybuta-1,3-dien-2-yl] acetate.
| Compound Name | [(1Z,3E)-1-[(7Z)-6-oxo-8-phenyl-3,4-dihydro-2H-1,5-dithiocin-7-yl]-4-phenyl-1-propan-2-yloxybuta-1,3-dien-2-yl] acetate |
|---|---|
| PubChem CID | 5469263 |
| Molecular Formula | C27H28O4S2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | [(1Z,3E)-1-[(7Z)-6-oxo-8-phenyl-3,4-dihydro-2H-1,5-dithiocin-7-yl]-4-phenyl-1-propan-2-yloxybuta-1,3-dien-2-yl] acetate |
| SMILES | CC(=O)OC(/C=C/c1ccccc1)=C(OC(C)C)/C1=C(\c2ccccc2)SCCCSC1=O |
| InChI | InChI=1S/C27H28O4S2/c1-19(2)30-25(23(31-20(3)28)16-15-21-11-6-4-7-12-21)24-26(22-13-8-5-9-14-22)32-17-10-18-33-27(24)29/h4-9,11-16,19H,10,17-18H2,1-3H3/b16-15+,25-23-,26-24- |
| InChIKey | UWMJYRJZPFKNII-ODCXACCNSA-N |
| XLogP | 6.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|