About (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one
(3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one (PubChem CID 5469267) has the molecular formula C19H15F2NO
and a molecular weight of 311.33 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one.
Molecular Properties
| Compound Name | (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one |
| PubChem CID | 5469267 |
| Molecular Formula | C19H15F2NO |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(F)cc2)CNC/C1=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15F2NO/c20-17-5-1-13(2-6-17)9-15-11-22-12-16(19(15)23)10-14-3-7-18(21)8-4-14/h1-10,22H,11-12H2/b15-9+,16-10+ |
| InChIKey | ASJBYMPCFLKDGD-KAVGSWPWSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one?
The IUPAC name of (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one (CID 5469267) is (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one.
What is the SMILES notation for (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one?
The canonical SMILES for (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one is O=C1/C(=C/c2ccc(F)cc2)CNC/C1=C\c1ccc(F)cc1.
What is the InChIKey of (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one?
The InChIKey is ASJBYMPCFLKDGD-KAVGSWPWSA-N. The full InChI is InChI=1S/C19H15F2NO/c20-17-5-1-13(2-6-17)9-15-11-22-12-16(19(15)23)10-14-3-7-18(21)8-4-14/h1-10,22H,11-12H2/b15-9+,16-10+.
What are the key properties of (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one?
(3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one has a molecular weight of 311.33 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one is sourced from PubChem (CID 5469267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).