C22H22N2Na2O4 — CID 54692963
disodium;(Z)-4-[2-methyl-4-[3-methyl-4-[[(Z)-3-oxidobut-2-enoyl]amino]phenyl]anilino]-4-oxobut-2-en-2-olate (PubChem CID 54692963) has the molecular formula C22H22N2Na2O4 and a molecular weight of 424.41 g/mol. Its IUPAC name is disodium;(Z)-4-[2-methyl-4-[3-methyl-4-[[(Z)-3-oxidobut-2-enoyl]amino]phenyl]anilino]-4-oxobut-2-en-2-olate.
| Compound Name | disodium;(Z)-4-[2-methyl-4-[3-methyl-4-[[(Z)-3-oxidobut-2-enoyl]amino]phenyl]anilino]-4-oxobut-2-en-2-olate |
|---|---|
| PubChem CID | 54692963 |
| Molecular Formula | C22H22N2Na2O4 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | disodium;(Z)-4-[2-methyl-4-[3-methyl-4-[[(Z)-3-oxidobut-2-enoyl]amino]phenyl]anilino]-4-oxobut-2-en-2-olate |
| SMILES | C/C([O-])=C/C(=O)Nc1ccc(-c2ccc(NC(=O)/C=C(/C)[O-])c(C)c2)cc1C.[Na+].[Na+] |
| InChI | InChI=1S/C22H24N2O4.2Na/c1-13-9-17(5-7-19(13)23-21(27)11-15(3)25)18-6-8-20(14(2)10-18)24-22(28)12-16(4)26;;/h5-12,25-26H,1-4H3,(H,23,27)(H,24,28);;/q;2*+1/p-2/b15-11-,16-12-;; |
| InChIKey | HXOJOSIMXTZZOD-NRGJZUQCSA-L |
| XLogP | -3.62 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|