C15H10O8 — CID 54692970
methyl 5,9-dihydroxy-2-methyl-4,6-dioxopyrano[3,4-g]chromene-8-carboxylate (PubChem CID 54692970) has the molecular formula C15H10O8 and a molecular weight of 318.24 g/mol. Its IUPAC name is methyl 5,9-dihydroxy-2-methyl-4,6-dioxopyrano[3,4-g]chromene-8-carboxylate.
| Compound Name | methyl 5,9-dihydroxy-2-methyl-4,6-dioxopyrano[3,4-g]chromene-8-carboxylate |
|---|---|
| PubChem CID | 54692970 |
| Molecular Formula | C15H10O8 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | methyl 5,9-dihydroxy-2-methyl-4,6-dioxopyrano[3,4-g]chromene-8-carboxylate |
| SMILES | COC(=O)c1oc(=O)c2c(O)c3c(=O)cc(C)oc3cc2c1O |
| InChI | InChI=1S/C15H10O8/c1-5-3-7(16)10-8(22-5)4-6-9(12(10)18)14(19)23-13(11(6)17)15(20)21-2/h3-4,17-18H,1-2H3 |
| InChIKey | JSQAILNRMPHAGO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|