About aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate
aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate (PubChem CID 54692986) has the molecular formula C14H27AlO7
and a molecular weight of 334.35 g/mol. Its IUPAC name is aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate.
Molecular Properties
| Compound Name | aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate |
| PubChem CID | 54692986 |
| Molecular Formula | C14H27AlO7 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate |
| SMILES | CCOC(=O)/C=C(/C)[O-].CCOCC[O-].CCOCC[O-].[Al+3] |
| InChI | InChI=1S/C6H10O3.2C4H9O2.Al/c1-3-9-6(8)4-5(2)7;2*1-2-6-4-3-5;/h4,7H,3H2,1-2H3;2*2-4H2,1H3;/q;2*-1;+3/p-1/b5-4-;;; |
| InChIKey | ZWKRDYUJVMKFBE-OAWHIZORSA-M |
| XLogP | -1.80 |
| TPSA | 113.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate?
The IUPAC name of aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate (CID 54692986) is aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate.
What is the SMILES notation for aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate?
The canonical SMILES for aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate is CCOC(=O)/C=C(/C)[O-].CCOCC[O-].CCOCC[O-].[Al+3].
What is the InChIKey of aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate?
The InChIKey is ZWKRDYUJVMKFBE-OAWHIZORSA-M. The full InChI is InChI=1S/C6H10O3.2C4H9O2.Al/c1-3-9-6(8)4-5(2)7;2*1-2-6-4-3-5;/h4,7H,3H2,1-2H3;2*2-4H2,1H3;/q;2*-1;+3/p-1/b5-4-;;;.
What are the key properties of aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate?
aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate has a molecular weight of 334.35 g/mol, XLogP of -1.80, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;bis(2-ethoxyethanolate);(Z)-4-ethoxy-4-oxobut-2-en-2-olate is sourced from PubChem (CID 54692986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).