C31H24O3 — CID 54693129
4-hydroxy-3-[(1S,3R)-3-(4-phenylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]chromen-2-one (PubChem CID 54693129) has the molecular formula C31H24O3 and a molecular weight of 444.53 g/mol. Its IUPAC name is 4-hydroxy-3-[(1S,3R)-3-(4-phenylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[(1S,3R)-3-(4-phenylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]chromen-2-one |
|---|---|
| PubChem CID | 54693129 |
| Molecular Formula | C31H24O3 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 4-hydroxy-3-[(1S,3R)-3-(4-phenylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1[C@H]1C[C@@H](c2ccc(-c3ccccc3)cc2)Cc2ccccc21 |
| InChI | InChI=1S/C31H24O3/c32-30-26-12-6-7-13-28(26)34-31(33)29(30)27-19-24(18-23-10-4-5-11-25(23)27)22-16-14-21(15-17-22)20-8-2-1-3-9-20/h1-17,24,27,32H,18-19H2/t24-,27-/m0/s1 |
| InChIKey | FVQITOLOYMWVFU-IGKIAQTJSA-N |
| XLogP | 7.03 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|