About ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate
ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 54693139) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 54693139 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(O)CCC=C1 |
| InChI | InChI=1S/C9H12O3/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3,5,10H,2,4,6H2,1H3 |
| InChIKey | NQAPUAIEVSHBAD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate (CID 54693139) is ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate is CCOC(=O)C1=C(O)CCC=C1.
What is the InChIKey of ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate?
The InChIKey is NQAPUAIEVSHBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3,5,10H,2,4,6H2,1H3.
What are the key properties of ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate?
ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate has a molecular weight of 168.19 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxycyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 54693139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).