About 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione
5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 54693142) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione.
Molecular Properties
| Compound Name | 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| PubChem CID | 54693142 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC(O)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C8H10O5/c1-4(9)5-6(10)12-8(2,3)13-7(5)11/h9H,1-3H3 |
| InChIKey | WIIDJHLROTYVRD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione?
The IUPAC name of 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (CID 54693142) is 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione.
What is the SMILES notation for 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione?
The canonical SMILES for 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione is CC(O)=C1C(=O)OC(C)(C)OC1=O.
What is the InChIKey of 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione?
The InChIKey is WIIDJHLROTYVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c1-4(9)5-6(10)12-8(2,3)13-7(5)11/h9H,1-3H3.
What are the key properties of 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione?
5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione has a molecular weight of 186.16 g/mol, XLogP of 0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione is sourced from PubChem (CID 54693142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).