C24H42O8Si — CID 5469340
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2S)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]oxyoxane-3,4,5-triol (PubChem CID 5469340) has the molecular formula C24H42O8Si and a molecular weight of 486.68 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2S)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2S)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 5469340 |
| Molecular Formula | C24H42O8Si |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2S)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]oxyoxane-3,4,5-triol |
| SMILES | COc1ccc(COCC[C@H](C)OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C24H42O8Si/c1-16(12-13-29-14-17-8-10-18(28-5)11-9-17)31-23-22(27)21(26)20(25)19(32-23)15-30-33(6,7)24(2,3)4/h8-11,16,19-23,25-27H,12-15H2,1-7H3/t16-,19?,20?,21?,22?,23?/m0/s1 |
| InChIKey | JCEHMHPUDMTGQR-ABNMGAQLSA-N |
| XLogP | 2.84 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|