About 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium
4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium (PubChem CID 54694307) has the molecular formula C20H13BrN3O3S+
and a molecular weight of 455.31 g/mol. Its IUPAC name is 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium |
| PubChem CID | 54694307 |
| Molecular Formula | C20H13BrN3O3S+ |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium |
| SMILES | COc1ccc(-c2cc3c(s2)c(O)c([N+]#N)c(=O)n3-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H12BrN3O3S/c1-27-14-8-2-11(3-9-14)16-10-15-19(28-16)18(25)17(23-22)20(26)24(15)13-6-4-12(21)5-7-13/h2-10H,1H3/p+1 |
| InChIKey | MKHKIDHKVZMMSC-UHFFFAOYSA-O |
| XLogP | 5.68 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium?
The IUPAC name of 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium (CID 54694307) is 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium.
What is the SMILES notation for 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium?
The canonical SMILES for 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium is COc1ccc(-c2cc3c(s2)c(O)c([N+]#N)c(=O)n3-c2ccc(Br)cc2)cc1.
What is the InChIKey of 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium?
The InChIKey is MKHKIDHKVZMMSC-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H12BrN3O3S/c1-27-14-8-2-11(3-9-14)16-10-15-19(28-16)18(25)17(23-22)20(26)24(15)13-6-4-12(21)5-7-13/h2-10H,1H3/p+1.
What are the key properties of 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium?
4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium has a molecular weight of 455.31 g/mol, XLogP of 5.68, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-7-hydroxy-2-(4-methoxyphenyl)-5-oxothieno[3,2-b]pyridine-6-diazonium is sourced from PubChem (CID 54694307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).