About 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one
4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one (PubChem CID 54694329) has the molecular formula C19H19NO2
and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one |
| PubChem CID | 54694329 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one |
| SMILES | Cc1cc(C)c(-c2c(O)c3ccccc3n(C)c2=O)c(C)c1 |
| InChI | InChI=1S/C19H19NO2/c1-11-9-12(2)16(13(3)10-11)17-18(21)14-7-5-6-8-15(14)20(4)19(17)22/h5-10,21H,1-4H3 |
| InChIKey | LEIAVWWANCNTJJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one?
The IUPAC name of 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one (CID 54694329) is 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one.
What is the SMILES notation for 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one?
The canonical SMILES for 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one is Cc1cc(C)c(-c2c(O)c3ccccc3n(C)c2=O)c(C)c1.
What is the InChIKey of 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one?
The InChIKey is LEIAVWWANCNTJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO2/c1-11-9-12(2)16(13(3)10-11)17-18(21)14-7-5-6-8-15(14)20(4)19(17)22/h5-10,21H,1-4H3.
What are the key properties of 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one?
4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one has a molecular weight of 293.37 g/mol, XLogP of 3.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1-methyl-3-(2,4,6-trimethylphenyl)quinolin-2-one is sourced from PubChem (CID 54694329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).