C16H26O3 — CID 5469451
methyl (2E,6E)-5-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoate (PubChem CID 5469451) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is methyl (2E,6E)-5-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoate.
| Compound Name | methyl (2E,6E)-5-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 5469451 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | methyl (2E,6E)-5-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoate |
| SMILES | COC(=O)/C=C(\C)CC(O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H26O3/c1-12(2)7-6-8-13(3)9-15(17)10-14(4)11-16(18)19-5/h7,9,11,15,17H,6,8,10H2,1-5H3/b13-9+,14-11+ |
| InChIKey | WNWGVZFTVATBCH-IJFRVEDASA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|