C24H36O4S — CID 5469500
methyl (E)-7-hydroxy-9-methyl-13-phenylsulfanyl-8-propanoyltridec-10-enoate (PubChem CID 5469500) has the molecular formula C24H36O4S and a molecular weight of 420.62 g/mol. Its IUPAC name is methyl (E)-7-hydroxy-9-methyl-13-phenylsulfanyl-8-propanoyltridec-10-enoate.
| Compound Name | methyl (E)-7-hydroxy-9-methyl-13-phenylsulfanyl-8-propanoyltridec-10-enoate |
|---|---|
| PubChem CID | 5469500 |
| Molecular Formula | C24H36O4S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | methyl (E)-7-hydroxy-9-methyl-13-phenylsulfanyl-8-propanoyltridec-10-enoate |
| SMILES | CCC(=O)C(C(C)/C=C/CCSc1ccccc1)C(O)CCCCCC(=O)OC |
| InChI | InChI=1S/C24H36O4S/c1-4-21(25)24(22(26)16-9-6-10-17-23(27)28-3)19(2)13-11-12-18-29-20-14-7-5-8-15-20/h5,7-8,11,13-15,19,22,24,26H,4,6,9-10,12,16-18H2,1-3H3/b13-11+ |
| InChIKey | NLKNRIQOWCDPRF-ACCUITESSA-N |
| XLogP | 5.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|