C31H60O6Si2 — CID 5469501
methyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-5-oxocyclopentyl]-7-hydroxyheptanoate (PubChem CID 5469501) has the molecular formula C31H60O6Si2 and a molecular weight of 584.99 g/mol. Its IUPAC name is methyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-5-oxocyclopentyl]-7-hydroxyheptanoate.
| Compound Name | methyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-5-oxocyclopentyl]-7-hydroxyheptanoate |
|---|---|
| PubChem CID | 5469501 |
| Molecular Formula | C31H60O6Si2 |
| Molecular Weight | 584.99 g/mol |
| Exact Mass | 584.39 |
| IUPAC Name | methyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-5-oxocyclopentyl]-7-hydroxyheptanoate |
| SMILES | CCCCC(C)(C/C=C/[C@@H]1[C@@H](C(O)CCCCCC(=O)OC)C(=O)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C31H60O6Si2/c1-12-13-21-31(5,37-38(7,8)9)22-17-18-24-27(36-39(10,11)30(2,3)4)23-26(33)29(24)25(32)19-15-14-16-20-28(34)35-6/h17-18,24-25,27,29,32H,12-16,19-23H2,1-11H3/b18-17+/t24-,25?,27+,29-,31?/m0/s1 |
| InChIKey | CDLLQQUCUNYKKE-BEWXUERZSA-N |
| XLogP | 7.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.99 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|