C31H58O8Si — CID 5469505
methyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-(2-methoxyethoxymethoxy)oct-1-enyl]-5-oxocyclopentyl]-7-hydroxyheptanoate (PubChem CID 5469505) has the molecular formula C31H58O8Si and a molecular weight of 586.88 g/mol. Its IUPAC name is methyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-(2-methoxyethoxymethoxy)oct-1-enyl]-5-oxocyclopentyl]-7-hydroxyheptanoate.
| Compound Name | methyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-(2-methoxyethoxymethoxy)oct-1-enyl]-5-oxocyclopentyl]-7-hydroxyheptanoate |
|---|---|
| PubChem CID | 5469505 |
| Molecular Formula | C31H58O8Si |
| Molecular Weight | 586.88 g/mol |
| Exact Mass | 586.39 |
| IUPAC Name | methyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-(2-methoxyethoxymethoxy)oct-1-enyl]-5-oxocyclopentyl]-7-hydroxyheptanoate |
| SMILES | CCCCCC(/C=C/[C@@H]1[C@@H](C(O)CCCCCC(=O)OC)C(=O)C[C@H]1O[Si](C)(C)C(C)(C)C)OCOCCOC |
| InChI | InChI=1S/C31H58O8Si/c1-9-10-12-15-24(38-23-37-21-20-35-5)18-19-25-28(39-40(7,8)31(2,3)4)22-27(33)30(25)26(32)16-13-11-14-17-29(34)36-6/h18-19,24-26,28,30,32H,9-17,20-23H2,1-8H3/b19-18+/t24?,25-,26?,28+,30-/m0/s1 |
| InChIKey | TXNZEFWXAGSEPE-OAHITEERSA-N |
| XLogP | 6.21 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.88 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|