C28H46O4Si — CID 5469506
(2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1-hydroxyhexyl)-3-[(E)-4-phenylmethoxybut-1-enyl]cyclopentan-1-one (PubChem CID 5469506) has the molecular formula C28H46O4Si and a molecular weight of 474.76 g/mol. Its IUPAC name is (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1-hydroxyhexyl)-3-[(E)-4-phenylmethoxybut-1-enyl]cyclopentan-1-one.
| Compound Name | (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1-hydroxyhexyl)-3-[(E)-4-phenylmethoxybut-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 5469506 |
| Molecular Formula | C28H46O4Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1-hydroxyhexyl)-3-[(E)-4-phenylmethoxybut-1-enyl]cyclopentan-1-one |
| SMILES | CCCCCC(O)[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1/C=C/CCOCc1ccccc1 |
| InChI | InChI=1S/C28H46O4Si/c1-7-8-10-18-24(29)27-23(17-13-14-19-31-21-22-15-11-9-12-16-22)26(20-25(27)30)32-33(5,6)28(2,3)4/h9,11-13,15-17,23-24,26-27,29H,7-8,10,14,18-21H2,1-6H3/b17-13+/t23-,24?,26+,27-/m0/s1 |
| InChIKey | IWQUVUIDHNEBRL-DCLLBNFDSA-N |
| XLogP | 6.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|