About ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate
ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate (PubChem CID 5469556) has the molecular formula C14H19NO4
and a molecular weight of 265.31 g/mol. Its IUPAC name is ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate.
Molecular Properties
| Compound Name | ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate |
| PubChem CID | 5469556 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate |
| SMILES | CCOC(=O)CO/N=C/C1=CC(=O)C2CC1C2(C)C |
| InChI | InChI=1S/C14H19NO4/c1-4-18-13(17)8-19-15-7-9-5-12(16)11-6-10(9)14(11,2)3/h5,7,10-11H,4,6,8H2,1-3H3/b15-7+ |
| InChIKey | KLTWOVVNRHJQKX-VIZOYTHASA-N |
| XLogP | 1.72 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate?
The IUPAC name of ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate (CID 5469556) is ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate.
What is the SMILES notation for ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate?
The canonical SMILES for ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate is CCOC(=O)CO/N=C/C1=CC(=O)C2CC1C2(C)C.
What is the InChIKey of ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate?
The InChIKey is KLTWOVVNRHJQKX-VIZOYTHASA-N. The full InChI is InChI=1S/C14H19NO4/c1-4-18-13(17)8-19-15-7-9-5-12(16)11-6-10(9)14(11,2)3/h5,7,10-11H,4,6,8H2,1-3H3/b15-7+.
What are the key properties of ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate?
ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate has a molecular weight of 265.31 g/mol, XLogP of 1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(E)-(6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]oxyacetate is sourced from PubChem (CID 5469556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).