About 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid
4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid (PubChem CID 546958) has the molecular formula C9H16NO4+
and a molecular weight of 202.23 g/mol. Its IUPAC name is 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid |
| PubChem CID | 546958 |
| Molecular Formula | C9H16NO4+ |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid |
| SMILES | CC(=O)OC1CC(C(=O)O)[N+](C)(C)C1 |
| InChI | InChI=1S/C9H15NO4/c1-6(11)14-7-4-8(9(12)13)10(2,3)5-7/h7-8H,4-5H2,1-3H3/p+1 |
| InChIKey | YIIAUPFHPLUHQN-UHFFFAOYSA-O |
| XLogP | -0.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid?
The IUPAC name of 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid (CID 546958) is 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid.
What is the SMILES notation for 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid?
The canonical SMILES for 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid is CC(=O)OC1CC(C(=O)O)[N+](C)(C)C1.
What is the InChIKey of 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid?
The InChIKey is YIIAUPFHPLUHQN-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H15NO4/c1-6(11)14-7-4-8(9(12)13)10(2,3)5-7/h7-8H,4-5H2,1-3H3/p+1.
What are the key properties of 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid?
4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid has a molecular weight of 202.23 g/mol, XLogP of -0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyloxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid is sourced from PubChem (CID 546958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).