About N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine
N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine (PubChem CID 5469586) has the molecular formula C6H7N5
and a molecular weight of 149.16 g/mol. Its IUPAC name is N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine.
Molecular Properties
| Compound Name | N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine |
| PubChem CID | 5469586 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine |
| SMILES | CNc1nncc2[nH]cnc12 |
| InChI | InChI=1S/C6H7N5/c1-7-6-5-4(2-10-11-6)8-3-9-5/h2-3H,1H3,(H,7,11)(H,8,9) |
| InChIKey | BNGFPYLLQCQZQF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine?
The IUPAC name of N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine (CID 5469586) is N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine.
What is the SMILES notation for N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine?
The canonical SMILES for N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine is CNc1nncc2[nH]cnc12.
What is the InChIKey of N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine?
The InChIKey is BNGFPYLLQCQZQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5/c1-7-6-5-4(2-10-11-6)8-3-9-5/h2-3H,1H3,(H,7,11)(H,8,9).
What are the key properties of N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine?
N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine has a molecular weight of 149.16 g/mol, XLogP of 0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1H-imidazo[4,5-d]pyridazin-4-amine is sourced from PubChem (CID 5469586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).