About 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine
4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine (PubChem CID 5469591) has the molecular formula C6H6N4S
and a molecular weight of 166.21 g/mol. Its IUPAC name is 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine.
Molecular Properties
| Compound Name | 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine |
| PubChem CID | 5469591 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine |
| SMILES | CSc1nncc2[nH]cnc12 |
| InChI | InChI=1S/C6H6N4S/c1-11-6-5-4(2-9-10-6)7-3-8-5/h2-3H,1H3,(H,7,8) |
| InChIKey | ROMSPVUYLMFSBM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine?
The IUPAC name of 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine (CID 5469591) is 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine.
What is the SMILES notation for 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine?
The canonical SMILES for 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine is CSc1nncc2[nH]cnc12.
What is the InChIKey of 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine?
The InChIKey is ROMSPVUYLMFSBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S/c1-11-6-5-4(2-9-10-6)7-3-8-5/h2-3H,1H3,(H,7,8).
What are the key properties of 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine?
4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine has a molecular weight of 166.21 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-1H-imidazo[4,5-d]pyridazine is sourced from PubChem (CID 5469591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).