C12H32Cl2FeN4 — CID 546960
dichloroiron;bis(N,N,N',N'-tetramethylethane-1,2-diamine) (PubChem CID 546960) has the molecular formula C12H32Cl2FeN4 and a molecular weight of 359.17 g/mol. Its IUPAC name is dichloroiron;bis(N,N,N',N'-tetramethylethane-1,2-diamine).
| Compound Name | dichloroiron;bis(N,N,N',N'-tetramethylethane-1,2-diamine) |
|---|---|
| PubChem CID | 546960 |
| Molecular Formula | C12H32Cl2FeN4 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | dichloroiron;bis(N,N,N',N'-tetramethylethane-1,2-diamine) |
| SMILES | CN(C)CCN(C)C.CN(C)CCN(C)C.Cl[Fe]Cl |
| InChI | InChI=1S/2C6H16N2.2ClH.Fe/c2*1-7(2)5-6-8(3)4;;;/h2*5-6H2,1-4H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | CWXTVIRLTZNCAC-UHFFFAOYSA-L |
| XLogP | 1.60 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|