C22H36O5 — CID 5469632
methyl 1-[(1S,4E,9S,10S,11R,12S,14R)-10,14-dihydroxy-1,5,9-trimethyl-15-oxabicyclo[9.3.1]pentadec-4-en-12-yl]cyclopropane-1-carboxylate (PubChem CID 5469632) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is methyl 1-[(1S,4E,9S,10S,11R,12S,14R)-10,14-dihydroxy-1,5,9-trimethyl-15-oxabicyclo[9.3.1]pentadec-4-en-12-yl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[(1S,4E,9S,10S,11R,12S,14R)-10,14-dihydroxy-1,5,9-trimethyl-15-oxabicyclo[9.3.1]pentadec-4-en-12-yl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 5469632 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | methyl 1-[(1S,4E,9S,10S,11R,12S,14R)-10,14-dihydroxy-1,5,9-trimethyl-15-oxabicyclo[9.3.1]pentadec-4-en-12-yl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1([C@@H]2C[C@@H](O)[C@]3(C)CC/C=C(\C)CCC[C@H](C)[C@H](O)[C@@H]2O3)CC1 |
| InChI | InChI=1S/C22H36O5/c1-14-7-5-9-15(2)18(24)19-16(22(11-12-22)20(25)26-4)13-17(23)21(3,27-19)10-6-8-14/h8,15-19,23-24H,5-7,9-13H2,1-4H3/b14-8+/t15-,16+,17+,18-,19+,21-/m0/s1 |
| InChIKey | KHHOOLUXFFPRTF-AHBGHTJRSA-N |
| XLogP | 3.37 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|