About 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one
4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one (PubChem CID 54696332) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one |
| PubChem CID | 54696332 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one |
| SMILES | CC1=C(O)CC(C)OC1=O |
| InChI | InChI=1S/C7H10O3/c1-4-3-6(8)5(2)7(9)10-4/h4,8H,3H2,1-2H3 |
| InChIKey | MXEJFXRULRDYHS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one?
The IUPAC name of 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one (CID 54696332) is 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one.
What is the SMILES notation for 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one?
The canonical SMILES for 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one is CC1=C(O)CC(C)OC1=O.
What is the InChIKey of 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one?
The InChIKey is MXEJFXRULRDYHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-4-3-6(8)5(2)7(9)10-4/h4,8H,3H2,1-2H3.
What are the key properties of 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one?
4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one has a molecular weight of 142.15 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,5-dimethyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 54696332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).