About diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate
diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate (PubChem CID 54696408) has the molecular formula C17H24O6
and a molecular weight of 324.37 g/mol. Its IUPAC name is diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate.
Molecular Properties
| Compound Name | diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate |
| PubChem CID | 54696408 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate |
| SMILES | CCOC(=O)/C(C)=C(\C(=O)OCC)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C17H24O6/c1-6-22-15(20)10(3)13(16(21)23-7-2)14-11(18)8-17(4,5)9-12(14)19/h18H,6-9H2,1-5H3/b13-10- |
| InChIKey | UUKSDFLZGNZACL-RAXLEYEMSA-N |
| XLogP | 2.63 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate?
The IUPAC name of diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate (CID 54696408) is diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate.
What is the SMILES notation for diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate?
The canonical SMILES for diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate is CCOC(=O)/C(C)=C(\C(=O)OCC)C1=C(O)CC(C)(C)CC1=O.
What is the InChIKey of diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate?
The InChIKey is UUKSDFLZGNZACL-RAXLEYEMSA-N. The full InChI is InChI=1S/C17H24O6/c1-6-22-15(20)10(3)13(16(21)23-7-2)14-11(18)8-17(4,5)9-12(14)19/h18H,6-9H2,1-5H3/b13-10-.
What are the key properties of diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate?
diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate has a molecular weight of 324.37 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (Z)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate is sourced from PubChem (CID 54696408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).