About 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one
5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 54696473) has the molecular formula C10H3ClF3N3O6
and a molecular weight of 353.60 g/mol. Its IUPAC name is 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one |
| PubChem CID | 54696473 |
| Molecular Formula | C10H3ClF3N3O6 |
| Molecular Weight | 353.60 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2cc(C(F)(F)F)c([N+](=O)[O-])c(Cl)c2c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H3ClF3N3O6/c11-5-4-3(15-9(19)7(8(4)18)17(22)23)1-2(10(12,13)14)6(5)16(20)21/h1H,(H2,15,18,19) |
| InChIKey | ZIQZWWHEUMFCQG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one?
The IUPAC name of 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one (CID 54696473) is 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one.
What is the SMILES notation for 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one?
The canonical SMILES for 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one is O=c1[nH]c2cc(C(F)(F)F)c([N+](=O)[O-])c(Cl)c2c(O)c1[N+](=O)[O-].
What is the InChIKey of 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one?
The InChIKey is ZIQZWWHEUMFCQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3ClF3N3O6/c11-5-4-3(15-9(19)7(8(4)18)17(22)23)1-2(10(12,13)14)6(5)16(20)21/h1H,(H2,15,18,19).
What are the key properties of 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one?
5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one has a molecular weight of 353.60 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-hydroxy-3,6-dinitro-7-(trifluoromethyl)-1H-quinolin-2-one is sourced from PubChem (CID 54696473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).