C12H10O4S — CID 54697154
methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate (PubChem CID 54697154) has the molecular formula C12H10O4S and a molecular weight of 250.28 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate.
| Compound Name | methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 54697154 |
| Molecular Formula | C12H10O4S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccccc2)c(O)c1O |
| InChI | InChI=1S/C12H10O4S/c1-16-12(15)11-9(14)8(13)10(17-11)7-5-3-2-4-6-7/h2-6,13-14H,1H3 |
| InChIKey | YXOGXZXCWHBHTP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|