methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate

C12H10O4S — CID 54697154

IUPACmethyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate
SMILESCOC(=O)c1sc(-c2ccccc2)c(O)c1O
InChIInChI=1S/C12H10O4S/c1-16-12(15)11-9(14)8(13)10(17-11)7-5-3-2-4-6-7/h2-6,13-14H,1H3
InChIKeyYXOGXZXCWHBHTP-UHFFFAOYSA-N
MW250.28 g/mol
LogP2.61
Rot. Bonds2

About methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate

methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate (PubChem CID 54697154) has the molecular formula C12H10O4S and a molecular weight of 250.28 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate
PubChem CID54697154
Molecular FormulaC12H10O4S
Molecular Weight250.28 g/mol
Exact Mass250.03
IUPAC Namemethyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate
SMILESCOC(=O)c1sc(-c2ccccc2)c(O)c1O
InChIInChI=1S/C12H10O4S/c1-16-12(15)11-9(14)8(13)10(17-11)7-5-3-2-4-6-7/h2-6,13-14H,1H3
InChIKeyYXOGXZXCWHBHTP-UHFFFAOYSA-N
XLogP2.61
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.28
LogP ≤ 52.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}

Analyze methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate?
The IUPAC name of methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate (CID 54697154) is methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate.
What is the SMILES notation for methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate?
The canonical SMILES for methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate is COC(=O)c1sc(-c2ccccc2)c(O)c1O.
What is the InChIKey of methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate?
The InChIKey is YXOGXZXCWHBHTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4S/c1-16-12(15)11-9(14)8(13)10(17-11)7-5-3-2-4-6-7/h2-6,13-14H,1H3.
What are the key properties of methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate?
methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate has a molecular weight of 250.28 g/mol, XLogP of 2.61, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,4-dihydroxy-5-phenylthiophene-2-carboxylate is sourced from PubChem (CID 54697154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).