C23H31NO4 — CID 54697323
(3Z,5S)-5-[(4-hydroxyphenyl)methyl]-3-[(E,2S,4R)-1-hydroxy-2,4,6-trimethylnon-6-enylidene]pyrrolidine-2,4-dione (PubChem CID 54697323) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is (3Z,5S)-5-[(4-hydroxyphenyl)methyl]-3-[(E,2S,4R)-1-hydroxy-2,4,6-trimethylnon-6-enylidene]pyrrolidine-2,4-dione.
| Compound Name | (3Z,5S)-5-[(4-hydroxyphenyl)methyl]-3-[(E,2S,4R)-1-hydroxy-2,4,6-trimethylnon-6-enylidene]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 54697323 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (3Z,5S)-5-[(4-hydroxyphenyl)methyl]-3-[(E,2S,4R)-1-hydroxy-2,4,6-trimethylnon-6-enylidene]pyrrolidine-2,4-dione |
| SMILES | CC/C=C(\C)C[C@H](C)C[C@H](C)/C(O)=C1/C(=O)N[C@@H](Cc2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C23H31NO4/c1-5-6-14(2)11-15(3)12-16(4)21(26)20-22(27)19(24-23(20)28)13-17-7-9-18(25)10-8-17/h6-10,15-16,19,25-26H,5,11-13H2,1-4H3,(H,24,28)/b14-6+,21-20-/t15-,16-,19-/m0/s1 |
| InChIKey | KGVANRZKBPUYPV-PWFBFJQWSA-N |
| XLogP | 4.22 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|